chenodeoxycholic acid


; chenodeoxycholic acid; chenodesoxycholic acid
Links:🕷 ChemSpider, 📖 PubMed
MeSH:Cathartics; Gastrointestinal Agents
CAS RN:[474-25-9]
Formula:C24H40O4; 392.58 g/mol
InChiKey:RUDATBOHQWOJDD-BSWAIDMHSA-N
SMILES:C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Molecular structure of chenodeoxycholic acid
Melting point:119 °C
Log10 partition octanol / water:4.15

Isomers

chenodeoxycholic acid
Molecular structure of chenodeoxycholic acid
deoxycholic acid
Molecular structure of deoxycholic acid
3α,6β-dihydroxycholanic acid
Molecular structure of 3a,6b-dihydroxycholanic acid
3β,6β-dihydroxycholanic acid
Molecular structure of 3b,6b-dihydroxycholanic acid
3,7-dihydroxycholan-24-oic acid
Molecular structure of 3,7-dihydroxycholan-24-oic acid
hyodeoxycholic acid
Molecular structure of hyodeoxycholic acid
α-hyodeoxycholic acid
Molecular structure of a-hyodeoxycholic acid
ursodiol
Molecular structure of ursodiol